C23H18O4 — CID 6554166
(2R,3S,3'R)-3'-(2-methoxyphenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one (PubChem CID 6554166) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2R,3S,3'R)-3'-(2-methoxyphenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one.
| Compound Name | (2R,3S,3'R)-3'-(2-methoxyphenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 6554166 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2R,3S,3'R)-3'-(2-methoxyphenyl)-2-phenylspiro[2H-chromene-3,2'-oxirane]-4-one |
| SMILES | COc1ccccc1[C@H]1O[C@@]12C(=O)c1ccccc1O[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C23H18O4/c1-25-18-13-7-6-12-17(18)22-23(27-22)20(24)16-11-5-8-14-19(16)26-21(23)15-9-3-2-4-10-15/h2-14,21-22H,1H3/t21-,22-,23-/m1/s1 |
| InChIKey | SKQPRKACEDFNMK-DNVJHFABSA-N |
| XLogP | 4.52 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|