C24H19FO4 — CID 25213191
ethyl (2R,3R)-3-fluoro-4-oxo-2-(4-phenylphenyl)-2H-chromene-3-carboxylate (PubChem CID 25213191) has the molecular formula C24H19FO4 and a molecular weight of 390.41 g/mol. Its IUPAC name is ethyl (2R,3R)-3-fluoro-4-oxo-2-(4-phenylphenyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl (2R,3R)-3-fluoro-4-oxo-2-(4-phenylphenyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 25213191 |
| Molecular Formula | C24H19FO4 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | ethyl (2R,3R)-3-fluoro-4-oxo-2-(4-phenylphenyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(F)C(=O)c2ccccc2O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19FO4/c1-2-28-23(27)24(25)21(26)19-10-6-7-11-20(19)29-22(24)18-14-12-17(13-15-18)16-8-4-3-5-9-16/h3-15,22H,2H2,1H3/t22-,24+/m1/s1 |
| InChIKey | XYKYRZDKMQNONO-VWNXMTODSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|