C20H19FO3 — CID 172816125
ethyl 3-cyclopropyl-2-(4-fluorophenyl)-2H-1-benzofuran-3-carboxylate (PubChem CID 172816125) has the molecular formula C20H19FO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is ethyl 3-cyclopropyl-2-(4-fluorophenyl)-2H-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 3-cyclopropyl-2-(4-fluorophenyl)-2H-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 172816125 |
| Molecular Formula | C20H19FO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | ethyl 3-cyclopropyl-2-(4-fluorophenyl)-2H-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)C1(C2CC2)c2ccccc2OC1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FO3/c1-2-23-19(22)20(14-9-10-14)16-5-3-4-6-17(16)24-18(20)13-7-11-15(21)12-8-13/h3-8,11-12,14,18H,2,9-10H2,1H3 |
| InChIKey | SVFHXQFTWDNJMZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |