C17H17FO6 — CID 102492449
diethyl (3S)-3-(4-fluorophenyl)-4-methylidene-5-oxooxolane-2,2-dicarboxylate (PubChem CID 102492449) has the molecular formula C17H17FO6 and a molecular weight of 336.32 g/mol. Its IUPAC name is diethyl (3S)-3-(4-fluorophenyl)-4-methylidene-5-oxooxolane-2,2-dicarboxylate.
| Compound Name | diethyl (3S)-3-(4-fluorophenyl)-4-methylidene-5-oxooxolane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102492449 |
| Molecular Formula | C17H17FO6 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | diethyl (3S)-3-(4-fluorophenyl)-4-methylidene-5-oxooxolane-2,2-dicarboxylate |
| SMILES | C=C1C(=O)OC(C(=O)OCC)(C(=O)OCC)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FO6/c1-4-22-15(20)17(16(21)23-5-2)13(10(3)14(19)24-17)11-6-8-12(18)9-7-11/h6-9,13H,3-5H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZJGHVILZHUQKOD-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|