C25H23F3N2O5 — CID 162621155
diethyl 4-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)-4H-furo[3,2-d]pyrazole-5,5-dicarboxylate (PubChem CID 162621155) has the molecular formula C25H23F3N2O5 and a molecular weight of 488.46 g/mol. Its IUPAC name is diethyl 4-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)-4H-furo[3,2-d]pyrazole-5,5-dicarboxylate.
| Compound Name | diethyl 4-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)-4H-furo[3,2-d]pyrazole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 162621155 |
| Molecular Formula | C25H23F3N2O5 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | diethyl 4-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)-4H-furo[3,2-d]pyrazole-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2c(c(C(F)(F)F)nn2-c2ccccc2)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C25H23F3N2O5/c1-4-33-22(31)24(23(32)34-5-2)19(16-13-11-15(3)12-14-16)18-20(25(26,27)28)29-30(21(18)35-24)17-9-7-6-8-10-17/h6-14,19H,4-5H2,1-3H3 |
| InChIKey | UWCNWSJASPOVOZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|