C11H7ClF3N3O — CID 141062484
4-chloro-1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 141062484) has the molecular formula C11H7ClF3N3O and a molecular weight of 289.64 g/mol. Its IUPAC name is 4-chloro-1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141062484 |
| Molecular Formula | C11H7ClF3N3O |
| Molecular Weight | 289.64 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-chloro-1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | NC(=O)c1c(Cl)c(C(F)(F)F)nn1-c1ccccc1 |
| InChI | InChI=1S/C11H7ClF3N3O/c12-7-8(10(16)19)18(6-4-2-1-3-5-6)17-9(7)11(13,14)15/h1-5H,(H2,16,19) |
| InChIKey | LBYLMOBGGXZHRC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |