C18H10F6N2O — CID 162535186
phenyl-[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methanone (PubChem CID 162535186) has the molecular formula C18H10F6N2O and a molecular weight of 384.28 g/mol. Its IUPAC name is phenyl-[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methanone.
| Compound Name | phenyl-[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 162535186 |
| Molecular Formula | C18H10F6N2O |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | phenyl-[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methanone |
| SMILES | O=C(c1ccccc1)c1c(C(F)(F)F)nn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C18H10F6N2O/c19-17(20,21)15-13(14(27)11-7-3-1-4-8-11)16(18(22,23)24)26(25-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | CBRCUVKCSIFEHB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |