C19H15ClF3N3O2 — CID 66759630
[[1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]-phenylmethyl] carbamate (PubChem CID 66759630) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is [[1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]-phenylmethyl] carbamate.
| Compound Name | [[1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]-phenylmethyl] carbamate |
|---|---|
| PubChem CID | 66759630 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [[1-(3-chlorophenyl)-4-methyl-3-(trifluoromethyl)pyrazol-5-yl]-phenylmethyl] carbamate |
| SMILES | Cc1c(C(F)(F)F)nn(-c2cccc(Cl)c2)c1C(OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C19H15ClF3N3O2/c1-11-15(16(28-18(24)27)12-6-3-2-4-7-12)26(25-17(11)19(21,22)23)14-9-5-8-13(20)10-14/h2-10,16H,1H3,(H2,24,27) |
| InChIKey | POUBTLFDYPQIBU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |