C11H8F3N3O2 — CID 174205540
1-phenyl-3-(trifluoromethoxy)pyrazole-5-carboxamide (PubChem CID 174205540) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-phenyl-3-(trifluoromethoxy)pyrazole-5-carboxamide.
| Compound Name | 1-phenyl-3-(trifluoromethoxy)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174205540 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-phenyl-3-(trifluoromethoxy)pyrazole-5-carboxamide |
| SMILES | NC(=O)c1cc(OC(F)(F)F)nn1-c1ccccc1 |
| InChI | InChI=1S/C11H8F3N3O2/c12-11(13,14)19-9-6-8(10(15)18)17(16-9)7-4-2-1-3-5-7/h1-6H,(H2,15,18) |
| InChIKey | USLDXCDFPFQIOV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |