C13H15NO4 — CID 117059885
ethyl 2-carbamoyl-3-(4-methylphenyl)oxirane-2-carboxylate (PubChem CID 117059885) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is ethyl 2-carbamoyl-3-(4-methylphenyl)oxirane-2-carboxylate.
| Compound Name | ethyl 2-carbamoyl-3-(4-methylphenyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 117059885 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | ethyl 2-carbamoyl-3-(4-methylphenyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1(C(N)=O)OC1c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15NO4/c1-3-17-12(16)13(11(14)15)10(18-13)9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3,(H2,14,15) |
| InChIKey | KZFBQIAYNIDMHS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|