C24H28O4S — CID 102332393
diethyl (3R,5R)-3,5-bis(4-methylphenyl)thiolane-2,2-dicarboxylate (PubChem CID 102332393) has the molecular formula C24H28O4S and a molecular weight of 412.55 g/mol. Its IUPAC name is diethyl (3R,5R)-3,5-bis(4-methylphenyl)thiolane-2,2-dicarboxylate.
| Compound Name | diethyl (3R,5R)-3,5-bis(4-methylphenyl)thiolane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102332393 |
| Molecular Formula | C24H28O4S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | diethyl (3R,5R)-3,5-bis(4-methylphenyl)thiolane-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)S[C@@H](c2ccc(C)cc2)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28O4S/c1-5-27-22(25)24(23(26)28-6-2)20(18-11-7-16(3)8-12-18)15-21(29-24)19-13-9-17(4)10-14-19/h7-14,20-21H,5-6,15H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | VSMGQFKODHSVQG-NHCUHLMSSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|