C19H23NO5 — CID 141275291
diethyl (2R)-3-acetyl-2-(4-methylphenyl)-1,2-dihydropyrrole-5,5-dicarboxylate (PubChem CID 141275291) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is diethyl (2R)-3-acetyl-2-(4-methylphenyl)-1,2-dihydropyrrole-5,5-dicarboxylate.
| Compound Name | diethyl (2R)-3-acetyl-2-(4-methylphenyl)-1,2-dihydropyrrole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 141275291 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | diethyl (2R)-3-acetyl-2-(4-methylphenyl)-1,2-dihydropyrrole-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C=C(C(C)=O)[C@@H](c2ccc(C)cc2)N1 |
| InChI | InChI=1S/C19H23NO5/c1-5-24-17(22)19(18(23)25-6-2)11-15(13(4)21)16(20-19)14-9-7-12(3)8-10-14/h7-11,16,20H,5-6H2,1-4H3/t16-/m1/s1 |
| InChIKey | JRSQKXFTFHQXJJ-MRXNPFEDSA-N |
| XLogP | 2.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|