C19H25NO5 — CID 102326619
diethyl (3R,4R,5S)-4-formyl-3-methyl-5-(4-methylphenyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 102326619) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is diethyl (3R,4R,5S)-4-formyl-3-methyl-5-(4-methylphenyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4R,5S)-4-formyl-3-methyl-5-(4-methylphenyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102326619 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | diethyl (3R,4R,5S)-4-formyl-3-methyl-5-(4-methylphenyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2ccc(C)cc2)[C@H](C=O)[C@H]1C |
| InChI | InChI=1S/C19H25NO5/c1-5-24-17(22)19(18(23)25-6-2)13(4)15(11-21)16(20-19)14-9-7-12(3)8-10-14/h7-11,13,15-16,20H,5-6H2,1-4H3/t13-,15-,16-/m1/s1 |
| InChIKey | MUMLNQDSBUVSNK-FVQBIDKESA-N |
| XLogP | 1.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|