C21H28BrNO5 — CID 102325126
diethyl (3R,4R,5S)-5-(4-bromophenyl)-3-butyl-4-formylpyrrolidine-2,2-dicarboxylate (PubChem CID 102325126) has the molecular formula C21H28BrNO5 and a molecular weight of 454.36 g/mol. Its IUPAC name is diethyl (3R,4R,5S)-5-(4-bromophenyl)-3-butyl-4-formylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,4R,5S)-5-(4-bromophenyl)-3-butyl-4-formylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102325126 |
| Molecular Formula | C21H28BrNO5 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | diethyl (3R,4R,5S)-5-(4-bromophenyl)-3-butyl-4-formylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCCC[C@@H]1[C@@H](C=O)[C@@H](c2ccc(Br)cc2)NC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H28BrNO5/c1-4-7-8-17-16(13-24)18(14-9-11-15(22)12-10-14)23-21(17,19(25)27-5-2)20(26)28-6-3/h9-13,16-18,23H,4-8H2,1-3H3/t16-,17-,18-/m1/s1 |
| InChIKey | KJMPYOHZYBISAG-KZNAEPCWSA-N |
| XLogP | 3.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|