C23H21BrN2O8 — CID 132511075
diethyl (3R,3aS,9bR)-3-(4-bromophenyl)-8-nitro-4-oxo-1,3,3a,9b-tetrahydrochromeno[4,3-b]pyrrole-2,2-dicarboxylate (PubChem CID 132511075) has the molecular formula C23H21BrN2O8 and a molecular weight of 533.33 g/mol. Its IUPAC name is diethyl (3R,3aS,9bR)-3-(4-bromophenyl)-8-nitro-4-oxo-1,3,3a,9b-tetrahydrochromeno[4,3-b]pyrrole-2,2-dicarboxylate.
| Compound Name | diethyl (3R,3aS,9bR)-3-(4-bromophenyl)-8-nitro-4-oxo-1,3,3a,9b-tetrahydrochromeno[4,3-b]pyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 132511075 |
| Molecular Formula | C23H21BrN2O8 |
| Molecular Weight | 533.33 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | diethyl (3R,3aS,9bR)-3-(4-bromophenyl)-8-nitro-4-oxo-1,3,3a,9b-tetrahydrochromeno[4,3-b]pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H]2c3cc([N+](=O)[O-])ccc3OC(=O)[C@H]2[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H21BrN2O8/c1-3-32-21(28)23(22(29)33-4-2)18(12-5-7-13(24)8-6-12)17-19(25-23)15-11-14(26(30)31)9-10-16(15)34-20(17)27/h5-11,17-19,25H,3-4H2,1-2H3/t17-,18-,19-/m0/s1 |
| InChIKey | KXAIDEOPBDDHMT-FHWLQOOXSA-N |
| XLogP | 3.19 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|