C31H30N2O11 — CID 132551483
diethyl (2R,3'R,5'R)-3'-(3,4-dimethoxyphenyl)-5'-(2-hydroxy-5-nitrophenyl)-3-oxospiro[1-benzofuran-2,4'-pyrrolidine]-2',2'-dicarboxylate (PubChem CID 132551483) has the molecular formula C31H30N2O11 and a molecular weight of 606.58 g/mol. Its IUPAC name is diethyl (2R,3'R,5'R)-3'-(3,4-dimethoxyphenyl)-5'-(2-hydroxy-5-nitrophenyl)-3-oxospiro[1-benzofuran-2,4'-pyrrolidine]-2',2'-dicarboxylate.
| Compound Name | diethyl (2R,3'R,5'R)-3'-(3,4-dimethoxyphenyl)-5'-(2-hydroxy-5-nitrophenyl)-3-oxospiro[1-benzofuran-2,4'-pyrrolidine]-2',2'-dicarboxylate |
|---|---|
| PubChem CID | 132551483 |
| Molecular Formula | C31H30N2O11 |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | diethyl (2R,3'R,5'R)-3'-(3,4-dimethoxyphenyl)-5'-(2-hydroxy-5-nitrophenyl)-3-oxospiro[1-benzofuran-2,4'-pyrrolidine]-2',2'-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2cc([N+](=O)[O-])ccc2O)[C@]2(Oc3ccccc3C2=O)[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H30N2O11/c1-5-42-28(36)30(29(37)43-6-2)25(17-11-14-23(40-3)24(15-17)41-4)31(27(35)19-9-7-8-10-22(19)44-31)26(32-30)20-16-18(33(38)39)12-13-21(20)34/h7-16,25-26,32,34H,5-6H2,1-4H3/t25-,26-,31-/m1/s1 |
| InChIKey | KBIUGJUSPZJHKY-KQECVKDNSA-N |
| XLogP | 3.62 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|