C30H29NO7 — CID 138985099
diethyl (3R,3aS,9bR)-7-methoxy-4-oxo-3,3a-diphenyl-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate (PubChem CID 138985099) has the molecular formula C30H29NO7 and a molecular weight of 515.56 g/mol. Its IUPAC name is diethyl (3R,3aS,9bR)-7-methoxy-4-oxo-3,3a-diphenyl-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate.
| Compound Name | diethyl (3R,3aS,9bR)-7-methoxy-4-oxo-3,3a-diphenyl-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 138985099 |
| Molecular Formula | C30H29NO7 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | diethyl (3R,3aS,9bR)-7-methoxy-4-oxo-3,3a-diphenyl-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@@H]2c3ccc(OC)cc3OC(=O)[C@]2(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H29NO7/c1-4-36-27(33)30(28(34)37-5-2)24(19-12-8-6-9-13-19)29(20-14-10-7-11-15-20)25(31-30)22-17-16-21(35-3)18-23(22)38-26(29)32/h6-18,24-25,31H,4-5H2,1-3H3/t24-,25-,29-/m1/s1 |
| InChIKey | XNRGUSKENUIGEU-ITLAICGJSA-N |
| XLogP | 3.85 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|