C18H22O7 — CID 53495456
diethyl 6-methoxy-3-(2-oxopropyl)-3H-1-benzofuran-2,2-dicarboxylate (PubChem CID 53495456) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is diethyl 6-methoxy-3-(2-oxopropyl)-3H-1-benzofuran-2,2-dicarboxylate.
| Compound Name | diethyl 6-methoxy-3-(2-oxopropyl)-3H-1-benzofuran-2,2-dicarboxylate |
|---|---|
| PubChem CID | 53495456 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | diethyl 6-methoxy-3-(2-oxopropyl)-3H-1-benzofuran-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2cc(OC)ccc2C1CC(C)=O |
| InChI | InChI=1S/C18H22O7/c1-5-23-16(20)18(17(21)24-6-2)14(9-11(3)19)13-8-7-12(22-4)10-15(13)25-18/h7-8,10,14H,5-6,9H2,1-4H3 |
| InChIKey | TXHQZKLJDDMHDE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|