C22H20BrClO6 — CID 53495731
diethyl 3-[2-(4-bromophenyl)-2-oxoethyl]-5-chloro-3H-1-benzofuran-2,2-dicarboxylate (PubChem CID 53495731) has the molecular formula C22H20BrClO6 and a molecular weight of 495.75 g/mol. Its IUPAC name is diethyl 3-[2-(4-bromophenyl)-2-oxoethyl]-5-chloro-3H-1-benzofuran-2,2-dicarboxylate.
| Compound Name | diethyl 3-[2-(4-bromophenyl)-2-oxoethyl]-5-chloro-3H-1-benzofuran-2,2-dicarboxylate |
|---|---|
| PubChem CID | 53495731 |
| Molecular Formula | C22H20BrClO6 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | diethyl 3-[2-(4-bromophenyl)-2-oxoethyl]-5-chloro-3H-1-benzofuran-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2ccc(Cl)cc2C1CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrClO6/c1-3-28-20(26)22(21(27)29-4-2)17(16-11-15(24)9-10-19(16)30-22)12-18(25)13-5-7-14(23)8-6-13/h5-11,17H,3-4,12H2,1-2H3 |
| InChIKey | CEPAZTRONAADNE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|