C12H11ClO4 — CID 53496008
1-(2-acetyl-5-chloro-3-hydroxy-3H-1-benzofuran-2-yl)ethanone (PubChem CID 53496008) has the molecular formula C12H11ClO4 and a molecular weight of 254.67 g/mol. Its IUPAC name is 1-(2-acetyl-5-chloro-3-hydroxy-3H-1-benzofuran-2-yl)ethanone.
| Compound Name | 1-(2-acetyl-5-chloro-3-hydroxy-3H-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 53496008 |
| Molecular Formula | C12H11ClO4 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(2-acetyl-5-chloro-3-hydroxy-3H-1-benzofuran-2-yl)ethanone |
| SMILES | CC(=O)C1(C(C)=O)Oc2ccc(Cl)cc2C1O |
| InChI | InChI=1S/C12H11ClO4/c1-6(14)12(7(2)15)11(16)9-5-8(13)3-4-10(9)17-12/h3-5,11,16H,1-2H3 |
| InChIKey | PTKYWJMLXIKCSL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|