C24H22ClNO5 — CID 102344620
diethyl 5-chloro-3-(naphthalen-1-ylamino)-3H-1-benzofuran-2,2-dicarboxylate (PubChem CID 102344620) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is diethyl 5-chloro-3-(naphthalen-1-ylamino)-3H-1-benzofuran-2,2-dicarboxylate.
| Compound Name | diethyl 5-chloro-3-(naphthalen-1-ylamino)-3H-1-benzofuran-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102344620 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | diethyl 5-chloro-3-(naphthalen-1-ylamino)-3H-1-benzofuran-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2ccc(Cl)cc2C1Nc1cccc2ccccc12 |
| InChI | InChI=1S/C24H22ClNO5/c1-3-29-22(27)24(23(28)30-4-2)21(18-14-16(25)12-13-20(18)31-24)26-19-11-7-9-15-8-5-6-10-17(15)19/h5-14,21,26H,3-4H2,1-2H3 |
| InChIKey | QDLQDLYSACAIPP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|