C20H19Cl2NO5 — CID 102344616
diethyl 3-anilino-3,5-dichloro-1-benzofuran-2,2-dicarboxylate (PubChem CID 102344616) has the molecular formula C20H19Cl2NO5 and a molecular weight of 424.28 g/mol. Its IUPAC name is diethyl 3-anilino-3,5-dichloro-1-benzofuran-2,2-dicarboxylate.
| Compound Name | diethyl 3-anilino-3,5-dichloro-1-benzofuran-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102344616 |
| Molecular Formula | C20H19Cl2NO5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | diethyl 3-anilino-3,5-dichloro-1-benzofuran-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Oc2ccc(Cl)cc2C1(Cl)Nc1ccccc1 |
| InChI | InChI=1S/C20H19Cl2NO5/c1-3-26-17(24)19(18(25)27-4-2)20(22,23-14-8-6-5-7-9-14)15-12-13(21)10-11-16(15)28-19/h5-12,23H,3-4H2,1-2H3 |
| InChIKey | ZGRNYPMWZUENMM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|