C20H18Cl2N2O3S — CID 98351464
ethyl (1R,9S,13R)-4-chloro-10-(4-chlorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 98351464) has the molecular formula C20H18Cl2N2O3S and a molecular weight of 437.35 g/mol. Its IUPAC name is ethyl (1R,9S,13R)-4-chloro-10-(4-chlorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | ethyl (1R,9S,13R)-4-chloro-10-(4-chlorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 98351464 |
| Molecular Formula | C20H18Cl2N2O3S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | ethyl (1R,9S,13R)-4-chloro-10-(4-chlorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2NC(=S)N(c3ccc(Cl)cc3)[C@@]1(C)Oc1ccc(Cl)cc12 |
| InChI | InChI=1S/C20H18Cl2N2O3S/c1-3-26-18(25)16-17-14-10-12(22)6-9-15(14)27-20(16,2)24(19(28)23-17)13-7-4-11(21)5-8-13/h4-10,16-17H,3H2,1-2H3,(H,23,28)/t16-,17-,20-/m0/s1 |
| InChIKey | CUZPSEJVYQLVQH-ZWOKBUDYSA-N |
| XLogP | 4.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|