C20H17Cl2FN2O3S — CID 5069707
ethyl 4,6-dichloro-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 5069707) has the molecular formula C20H17Cl2FN2O3S and a molecular weight of 455.34 g/mol. Its IUPAC name is ethyl 4,6-dichloro-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | ethyl 4,6-dichloro-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 5069707 |
| Molecular Formula | C20H17Cl2FN2O3S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | ethyl 4,6-dichloro-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | CCOC(=O)C1C2NC(=S)N(c3ccc(F)cc3)C1(C)Oc1c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C20H17Cl2FN2O3S/c1-3-27-18(26)15-16-13-8-10(21)9-14(22)17(13)28-20(15,2)25(19(29)24-16)12-6-4-11(23)5-7-12/h4-9,15-16H,3H2,1-2H3,(H,24,29) |
| InChIKey | QWFLPSOBNJTQMQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|