C23H24ClN3O4S — CID 124775454
ethyl 4-[(1R,9S,13S)-4-chloro-13-(dimethylcarbamoyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzoate (PubChem CID 124775454) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is ethyl 4-[(1R,9S,13S)-4-chloro-13-(dimethylcarbamoyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzoate.
| Compound Name | ethyl 4-[(1R,9S,13S)-4-chloro-13-(dimethylcarbamoyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzoate |
|---|---|
| PubChem CID | 124775454 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | ethyl 4-[(1R,9S,13S)-4-chloro-13-(dimethylcarbamoyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=S)N[C@H]3c4cc(Cl)ccc4O[C@@]2(C)[C@H]3C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C23H24ClN3O4S/c1-5-30-21(29)13-6-9-15(10-7-13)27-22(32)25-19-16-12-14(24)8-11-17(16)31-23(27,2)18(19)20(28)26(3)4/h6-12,18-19H,5H2,1-4H3,(H,25,32)/t18-,19+,23+/m1/s1 |
| InChIKey | GGQHQBDFGWVDOX-MSYCTHLASA-N |
| XLogP | 3.77 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|