C21H20O7 — CID 102289558
methyl (3S,3aS,4R,9bS)-7-methoxy-4-(4-methoxyphenyl)-2-oxo-3,3a,4,9b-tetrahydrofuro[3,2-c]chromene-3-carboxylate (PubChem CID 102289558) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is methyl (3S,3aS,4R,9bS)-7-methoxy-4-(4-methoxyphenyl)-2-oxo-3,3a,4,9b-tetrahydrofuro[3,2-c]chromene-3-carboxylate.
| Compound Name | methyl (3S,3aS,4R,9bS)-7-methoxy-4-(4-methoxyphenyl)-2-oxo-3,3a,4,9b-tetrahydrofuro[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 102289558 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | methyl (3S,3aS,4R,9bS)-7-methoxy-4-(4-methoxyphenyl)-2-oxo-3,3a,4,9b-tetrahydrofuro[3,2-c]chromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)O[C@@H]2c3ccc(OC)cc3O[C@@H](c3ccc(OC)cc3)[C@H]12 |
| InChI | InChI=1S/C21H20O7/c1-24-12-6-4-11(5-7-12)18-16-17(20(22)26-3)21(23)28-19(16)14-9-8-13(25-2)10-15(14)27-18/h4-10,16-19H,1-3H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | YWSCUBYASXUGOB-CADBVGFASA-N |
| XLogP | 2.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|