C17H20O9 — CID 3840659
dimethyl 2-oxo-5-(2,4,5-trimethoxyphenyl)oxolane-3,4-dicarboxylate (PubChem CID 3840659) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is dimethyl 2-oxo-5-(2,4,5-trimethoxyphenyl)oxolane-3,4-dicarboxylate.
| Compound Name | dimethyl 2-oxo-5-(2,4,5-trimethoxyphenyl)oxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 3840659 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | dimethyl 2-oxo-5-(2,4,5-trimethoxyphenyl)oxolane-3,4-dicarboxylate |
| SMILES | COC(=O)C1C(=O)OC(c2cc(OC)c(OC)cc2OC)C1C(=O)OC |
| InChI | InChI=1S/C17H20O9/c1-21-9-7-11(23-3)10(22-2)6-8(9)14-12(15(18)24-4)13(16(19)25-5)17(20)26-14/h6-7,12-14H,1-5H3 |
| InChIKey | QUDJBVIBHMSYIT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|