C16H20N2O5S — CID 5051850
methyl 4-methylidene-2-sulfanylidene-6-(2,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxylate (PubChem CID 5051850) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is methyl 4-methylidene-2-sulfanylidene-6-(2,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxylate.
| Compound Name | methyl 4-methylidene-2-sulfanylidene-6-(2,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 5051850 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | methyl 4-methylidene-2-sulfanylidene-6-(2,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=S)NC(c2cc(OC)c(OC)cc2OC)C1C(=O)OC |
| InChI | InChI=1S/C16H20N2O5S/c1-8-13(15(19)23-5)14(18-16(24)17-8)9-6-11(21-3)12(22-4)7-10(9)20-2/h6-7,13-14H,1H2,2-5H3,(H2,17,18,24) |
| InChIKey | HFFAOHNFEOLWDC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|