C17H19N2O5S- — CID 2217341
(2S)-2-[4-[(4S,5S)-5-acetyl-6-methylidene-2-sulfanylidene-1,3-diazinan-4-yl]-2-methoxyphenoxy]propanoate (PubChem CID 2217341) has the molecular formula C17H19N2O5S- and a molecular weight of 363.42 g/mol. Its IUPAC name is (2S)-2-[4-[(4S,5S)-5-acetyl-6-methylidene-2-sulfanylidene-1,3-diazinan-4-yl]-2-methoxyphenoxy]propanoate.
| Compound Name | (2S)-2-[4-[(4S,5S)-5-acetyl-6-methylidene-2-sulfanylidene-1,3-diazinan-4-yl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 2217341 |
| Molecular Formula | C17H19N2O5S- |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2S)-2-[4-[(4S,5S)-5-acetyl-6-methylidene-2-sulfanylidene-1,3-diazinan-4-yl]-2-methoxyphenoxy]propanoate |
| SMILES | C=C1NC(=S)NC(c2ccc(O[C@@H](C)C(=O)[O-])c(OC)c2)[C@@H]1C(C)=O |
| InChI | InChI=1S/C17H20N2O5S/c1-8-14(9(2)20)15(19-17(25)18-8)11-5-6-12(13(7-11)23-4)24-10(3)16(21)22/h5-7,10,14-15H,1H2,2-4H3,(H,21,22)(H2,18,19,25)/p-1/t10-,14-,15?/m0/s1 |
| InChIKey | MSXHHKMDIAVQOQ-BNVJPMHFSA-M |
| XLogP | 0.45 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|