C21H30N2O5S — CID 2392028
2-methoxyethyl (4R,5S)-4-(2,4-dipropoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 2392028) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-methoxyethyl (4R,5S)-4-(2,4-dipropoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | 2-methoxyethyl (4R,5S)-4-(2,4-dipropoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2392028 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-methoxyethyl (4R,5S)-4-(2,4-dipropoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=S)N[C@@H](c2ccc(OCCC)cc2OCCC)[C@@H]1C(=O)OCCOC |
| InChI | InChI=1S/C21H30N2O5S/c1-5-9-26-15-7-8-16(17(13-15)27-10-6-2)19-18(14(3)22-21(29)23-19)20(24)28-12-11-25-4/h7-8,13,18-19H,3,5-6,9-12H2,1-2,4H3,(H2,22,23,29)/t18-,19+/m1/s1 |
| InChIKey | GECDCYFFNGUEQR-MOPGFXCFSA-N |
| XLogP | 3.10 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|