C15H16F2N2O4 — CID 2429272
2-methoxyethyl (4R,5R)-4-(2,4-difluorophenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 2429272) has the molecular formula C15H16F2N2O4 and a molecular weight of 326.30 g/mol. Its IUPAC name is 2-methoxyethyl (4R,5R)-4-(2,4-difluorophenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | 2-methoxyethyl (4R,5R)-4-(2,4-difluorophenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2429272 |
| Molecular Formula | C15H16F2N2O4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-methoxyethyl (4R,5R)-4-(2,4-difluorophenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=O)N[C@@H](c2ccc(F)cc2F)[C@H]1C(=O)OCCOC |
| InChI | InChI=1S/C15H16F2N2O4/c1-8-12(14(20)23-6-5-22-2)13(19-15(21)18-8)10-4-3-9(16)7-11(10)17/h3-4,7,12-13H,1,5-6H2,2H3,(H2,18,19,21)/t12-,13-/m0/s1 |
| InChIKey | BWWABMBYWPICJN-STQMWFEESA-N |
| XLogP | 1.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|