C19H20N2O4S — CID 2324276
2-methoxyethyl (4S,5R)-4-(2-hydroxynaphthalen-1-yl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 2324276) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-methoxyethyl (4S,5R)-4-(2-hydroxynaphthalen-1-yl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | 2-methoxyethyl (4S,5R)-4-(2-hydroxynaphthalen-1-yl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2324276 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-methoxyethyl (4S,5R)-4-(2-hydroxynaphthalen-1-yl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=S)N[C@H](c2c(O)ccc3ccccc23)[C@H]1C(=O)OCCOC |
| InChI | InChI=1S/C19H20N2O4S/c1-11-15(18(23)25-10-9-24-2)17(21-19(26)20-11)16-13-6-4-3-5-12(13)7-8-14(16)22/h3-8,15,17,22H,1,9-10H2,2H3,(H2,20,21,26)/t15-,17-/m0/s1 |
| InChIKey | MEBDHRPUFDPRKD-RDJZCZTQSA-N |
| XLogP | 2.38 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|