C16H19N3O6S — CID 2169506
ethyl (4S,5S)-4-(3-ethoxy-4-hydroxy-2-nitrophenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 2169506) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is ethyl (4S,5S)-4-(3-ethoxy-4-hydroxy-2-nitrophenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4S,5S)-4-(3-ethoxy-4-hydroxy-2-nitrophenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2169506 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | ethyl (4S,5S)-4-(3-ethoxy-4-hydroxy-2-nitrophenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=S)N[C@H](c2ccc(O)c(OCC)c2[N+](=O)[O-])[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C16H19N3O6S/c1-4-24-14-10(20)7-6-9(13(14)19(22)23)12-11(15(21)25-5-2)8(3)17-16(26)18-12/h6-7,11-12,20H,3-5H2,1-2H3,(H2,17,18,26)/t11-,12-/m1/s1 |
| InChIKey | ONRBIRMGYGUTAL-VXGBXAGGSA-N |
| XLogP | 1.91 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|