C23H26ClN3O6S — CID 2228326
(5S,6S)-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylidene-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxamide (PubChem CID 2228326) has the molecular formula C23H26ClN3O6S and a molecular weight of 508.00 g/mol. Its IUPAC name is (5S,6S)-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylidene-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxamide.
| Compound Name | (5S,6S)-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylidene-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2228326 |
| Molecular Formula | C23H26ClN3O6S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (5S,6S)-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylidene-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=S)N[C@H](c2cc(OC)c(OC)c(OC)c2)[C@@H]1C(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C23H26ClN3O6S/c1-11-19(22(28)26-14-10-15(29-2)13(24)9-16(14)30-3)20(27-23(34)25-11)12-7-17(31-4)21(33-6)18(8-12)32-5/h7-10,19-20H,1H2,2-6H3,(H,26,28)(H2,25,27,34)/t19-,20-/m1/s1 |
| InChIKey | HJGITQGYSMZYBF-WOJBJXKFSA-N |
| XLogP | 3.67 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|