C17H16ClN3O2S2 — CID 2452666
(5S,6R)-N-(4-chloro-2-methoxyphenyl)-4-methylidene-2-sulfanylidene-6-thiophen-2-yl-1,3-diazinane-5-carboxamide (PubChem CID 2452666) has the molecular formula C17H16ClN3O2S2 and a molecular weight of 393.92 g/mol. Its IUPAC name is (5S,6R)-N-(4-chloro-2-methoxyphenyl)-4-methylidene-2-sulfanylidene-6-thiophen-2-yl-1,3-diazinane-5-carboxamide.
| Compound Name | (5S,6R)-N-(4-chloro-2-methoxyphenyl)-4-methylidene-2-sulfanylidene-6-thiophen-2-yl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2452666 |
| Molecular Formula | C17H16ClN3O2S2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (5S,6R)-N-(4-chloro-2-methoxyphenyl)-4-methylidene-2-sulfanylidene-6-thiophen-2-yl-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=S)N[C@@H](c2cccs2)[C@@H]1C(=O)Nc1ccc(Cl)cc1OC |
| InChI | InChI=1S/C17H16ClN3O2S2/c1-9-14(15(21-17(24)19-9)13-4-3-7-25-13)16(22)20-11-6-5-10(18)8-12(11)23-2/h3-8,14-15H,1H2,2H3,(H,20,22)(H2,19,21,24)/t14-,15+/m1/s1 |
| InChIKey | OKXXIULBSRLMJO-CABCVRRESA-N |
| XLogP | 3.70 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|