C16H14N4O4S — CID 2377645
(5S,6R)-4-methylidene-N-(3-nitrophenyl)-2-oxo-6-thiophen-2-yl-1,3-diazinane-5-carboxamide (PubChem CID 2377645) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is (5S,6R)-4-methylidene-N-(3-nitrophenyl)-2-oxo-6-thiophen-2-yl-1,3-diazinane-5-carboxamide.
| Compound Name | (5S,6R)-4-methylidene-N-(3-nitrophenyl)-2-oxo-6-thiophen-2-yl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2377645 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (5S,6R)-4-methylidene-N-(3-nitrophenyl)-2-oxo-6-thiophen-2-yl-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=O)N[C@@H](c2cccs2)[C@@H]1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N4O4S/c1-9-13(14(19-16(22)17-9)12-6-3-7-25-12)15(21)18-10-4-2-5-11(8-10)20(23)24/h2-8,13-14H,1H2,(H,18,21)(H2,17,19,22)/t13-,14+/m1/s1 |
| InChIKey | BAUUFFYNBWOUPS-KGLIPLIRSA-N |
| XLogP | 2.78 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|