C20H20N4O6 — CID 2471978
(4S,5R)-4-(2,4-dimethoxyphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide (PubChem CID 2471978) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is (4S,5R)-4-(2,4-dimethoxyphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide.
| Compound Name | (4S,5R)-4-(2,4-dimethoxyphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2471978 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (4S,5R)-4-(2,4-dimethoxyphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=O)N[C@H](c2ccc(OC)cc2OC)[C@H]1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O6/c1-11-17(19(25)22-12-5-4-6-13(9-12)24(27)28)18(23-20(26)21-11)15-8-7-14(29-2)10-16(15)30-3/h4-10,17-18H,1H2,2-3H3,(H,22,25)(H2,21,23,26)/t17-,18+/m0/s1 |
| InChIKey | QUULGQPQTFREPK-ZWKOTPCHSA-N |
| XLogP | 2.73 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|