C20H20N4O4 — CID 2429702
(4R,5S)-4-(2,4-dimethylphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide (PubChem CID 2429702) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is (4R,5S)-4-(2,4-dimethylphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide.
| Compound Name | (4R,5S)-4-(2,4-dimethylphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2429702 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (4R,5S)-4-(2,4-dimethylphenyl)-6-methylidene-N-(3-nitrophenyl)-2-oxo-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=O)N[C@@H](c2ccc(C)cc2C)[C@@H]1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O4/c1-11-7-8-16(12(2)9-11)18-17(13(3)21-20(26)23-18)19(25)22-14-5-4-6-15(10-14)24(27)28/h4-10,17-18H,3H2,1-2H3,(H,22,25)(H2,21,23,26)/t17-,18+/m1/s1 |
| InChIKey | SCELYDPGXCOIEU-MSOLQXFVSA-N |
| XLogP | 3.33 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|