C25H28BrN3O3S — CID 2239108
(4S,5R)-N-benzyl-4-(3-bromo-4-cyclopentyloxy-5-methoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide (PubChem CID 2239108) has the molecular formula C25H28BrN3O3S and a molecular weight of 530.49 g/mol. Its IUPAC name is (4S,5R)-N-benzyl-4-(3-bromo-4-cyclopentyloxy-5-methoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide.
| Compound Name | (4S,5R)-N-benzyl-4-(3-bromo-4-cyclopentyloxy-5-methoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2239108 |
| Molecular Formula | C25H28BrN3O3S |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | (4S,5R)-N-benzyl-4-(3-bromo-4-cyclopentyloxy-5-methoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=S)N[C@H](c2cc(Br)c(OC3CCCC3)c(OC)c2)[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H28BrN3O3S/c1-15-21(24(30)27-14-16-8-4-3-5-9-16)22(29-25(33)28-15)17-12-19(26)23(20(13-17)31-2)32-18-10-6-7-11-18/h3-5,8-9,12-13,18,21-22H,1,6-7,10-11,14H2,2H3,(H,27,30)(H2,28,29,33)/t21-,22+/m0/s1 |
| InChIKey | DZVPIUORXHLKGO-FCHUYYIVSA-N |
| XLogP | 4.74 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|