C21H22N4O3S — CID 2236017
(4R,5R)-4-[2-(2-amino-2-oxoethoxy)phenyl]-N-benzyl-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide (PubChem CID 2236017) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is (4R,5R)-4-[2-(2-amino-2-oxoethoxy)phenyl]-N-benzyl-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide.
| Compound Name | (4R,5R)-4-[2-(2-amino-2-oxoethoxy)phenyl]-N-benzyl-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2236017 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (4R,5R)-4-[2-(2-amino-2-oxoethoxy)phenyl]-N-benzyl-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=S)N[C@@H](c2ccccc2OCC(N)=O)[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-13-18(20(27)23-11-14-7-3-2-4-8-14)19(25-21(29)24-13)15-9-5-6-10-16(15)28-12-17(22)26/h2-10,18-19H,1,11-12H2,(H2,22,26)(H,23,27)(H2,24,25,29)/t18-,19-/m0/s1 |
| InChIKey | ZDJZPQJHXOTXCN-OALUTQOASA-N |
| XLogP | 1.52 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|