C22H23N3O3 — CID 2236408
(5S,6R)-N-benzyl-4-methylidene-2-oxo-6-(2-prop-2-enoxyphenyl)-1,3-diazinane-5-carboxamide (PubChem CID 2236408) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (5S,6R)-N-benzyl-4-methylidene-2-oxo-6-(2-prop-2-enoxyphenyl)-1,3-diazinane-5-carboxamide.
| Compound Name | (5S,6R)-N-benzyl-4-methylidene-2-oxo-6-(2-prop-2-enoxyphenyl)-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2236408 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (5S,6R)-N-benzyl-4-methylidene-2-oxo-6-(2-prop-2-enoxyphenyl)-1,3-diazinane-5-carboxamide |
| SMILES | C=CCOc1ccccc1[C@@H]1NC(=O)NC(=C)[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-13-28-18-12-8-7-11-17(18)20-19(15(2)24-22(27)25-20)21(26)23-14-16-9-5-4-6-10-16/h3-12,19-20H,1-2,13-14H2,(H,23,26)(H2,24,25,27)/t19-,20+/m1/s1 |
| InChIKey | STNYCZZAQYTWOG-UXHICEINSA-N |
| XLogP | 3.05 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|