C16H20N2O3 — CID 2169550
(5S,6R)-5-acetyl-4-methylidene-6-(2-propoxyphenyl)-1,3-diazinan-2-one (PubChem CID 2169550) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (5S,6R)-5-acetyl-4-methylidene-6-(2-propoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | (5S,6R)-5-acetyl-4-methylidene-6-(2-propoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 2169550 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (5S,6R)-5-acetyl-4-methylidene-6-(2-propoxyphenyl)-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)N[C@@H](c2ccccc2OCCC)[C@@H]1C(C)=O |
| InChI | InChI=1S/C16H20N2O3/c1-4-9-21-13-8-6-5-7-12(13)15-14(11(3)19)10(2)17-16(20)18-15/h5-8,14-15H,2,4,9H2,1,3H3,(H2,17,18,20)/t14-,15-/m0/s1 |
| InChIKey | AFNJOVAIUHJNST-GJZGRUSLSA-N |
| XLogP | 2.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |