C18H23N3O4S — CID 2416829
[(4R,5S)-4-(2,3-dimethoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone (PubChem CID 2416829) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is [(4R,5S)-4-(2,3-dimethoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4R,5S)-4-(2,3-dimethoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 2416829 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [(4R,5S)-4-(2,3-dimethoxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone |
| SMILES | C=C1NC(=S)N[C@@H](c2cccc(OC)c2OC)[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H23N3O4S/c1-11-14(17(22)21-7-9-25-10-8-21)15(20-18(26)19-11)12-5-4-6-13(23-2)16(12)24-3/h4-6,14-15H,1,7-10H2,2-3H3,(H2,19,20,26)/t14-,15+/m1/s1 |
| InChIKey | XAYUUOFAVOUPEP-CABCVRRESA-N |
| XLogP | 1.21 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|