C16H19N3O3S — CID 2411564
[(4S,5S)-4-(4-hydroxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone (PubChem CID 2411564) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is [(4S,5S)-4-(4-hydroxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4S,5S)-4-(4-hydroxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 2411564 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(4S,5S)-4-(4-hydroxyphenyl)-6-methylidene-2-sulfanylidene-1,3-diazinan-5-yl]-morpholin-4-ylmethanone |
| SMILES | C=C1NC(=S)N[C@H](c2ccc(O)cc2)[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H19N3O3S/c1-10-13(15(21)19-6-8-22-9-7-19)14(18-16(23)17-10)11-2-4-12(20)5-3-11/h2-5,13-14,20H,1,6-9H2,(H2,17,18,23)/t13-,14-/m1/s1 |
| InChIKey | XTZZCFUXXCGQJU-ZIAGYGMSSA-N |
| XLogP | 0.90 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|