C21H21NO7 — CID 101182871
dimethyl (1R,8R,9S,10S)-4,5-dimethoxy-1-pyridin-4-yl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate (PubChem CID 101182871) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is dimethyl (1R,8R,9S,10S)-4,5-dimethoxy-1-pyridin-4-yl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8R,9S,10S)-4,5-dimethoxy-1-pyridin-4-yl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 101182871 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | dimethyl (1R,8R,9S,10S)-4,5-dimethoxy-1-pyridin-4-yl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2O[C@](c3ccncc3)(c3cc(OC)c(OC)cc32)[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H21NO7/c1-25-14-9-12-13(10-15(14)26-2)21(11-5-7-22-8-6-11)17(20(24)28-4)16(18(12)29-21)19(23)27-3/h5-10,16-18H,1-4H3/t16-,17+,18-,21+/m0/s1 |
| InChIKey | GNKPURZFODUTQJ-TWFHAPMSSA-N |
| XLogP | 2.01 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |