C19H22O10 — CID 6554364
tetramethyl (3R,4S,5S)-5-(4-methoxyphenyl)oxolane-2,2,3,4-tetracarboxylate (PubChem CID 6554364) has the molecular formula C19H22O10 and a molecular weight of 410.38 g/mol. Its IUPAC name is tetramethyl (3R,4S,5S)-5-(4-methoxyphenyl)oxolane-2,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl (3R,4S,5S)-5-(4-methoxyphenyl)oxolane-2,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 6554364 |
| Molecular Formula | C19H22O10 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | tetramethyl (3R,4S,5S)-5-(4-methoxyphenyl)oxolane-2,2,3,4-tetracarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccc(OC)cc2)OC(C(=O)OC)(C(=O)OC)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H22O10/c1-24-11-8-6-10(7-9-11)14-12(15(20)25-2)13(16(21)26-3)19(29-14,17(22)27-4)18(23)28-5/h6-9,12-14H,1-5H3/t12-,13-,14+/m0/s1 |
| InChIKey | CEZNEOSCPJMZRS-MELADBBJSA-N |
| XLogP | 0.43 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|