C13H15NO5 — CID 139842665
ethyl 5-(4-methoxyphenyl)-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 139842665) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl 5-(4-methoxyphenyl)-2-oxo-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl 5-(4-methoxyphenyl)-2-oxo-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 139842665 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl 5-(4-methoxyphenyl)-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1NC(=O)OC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H15NO5/c1-3-18-12(15)10-11(19-13(16)14-10)8-4-6-9(17-2)7-5-8/h4-7,10-11H,3H2,1-2H3,(H,14,16) |
| InChIKey | MKKHWUOMZYTBMS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |