C13H15NO6 — CID 90123803
5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid (PubChem CID 90123803) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 90123803 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| SMILES | COCCOc1ccc(C2OC(=O)NC2C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO6/c1-18-6-7-19-9-4-2-8(3-5-9)11-10(12(15)16)14-13(17)20-11/h2-5,10-11H,6-7H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | RPICQPFPECEULH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|