C14H17NO6 — CID 90123748
methyl 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 90123748) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 90123748 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methyl 5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | COCCOc1ccc(C2OC(=O)NC2C(=O)OC)cc1 |
| InChI | InChI=1S/C14H17NO6/c1-18-7-8-20-10-5-3-9(4-6-10)12-11(13(16)19-2)15-14(17)21-12/h3-6,11-12H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | LKHQWGOINBBZRU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|