C19H32NO5Si+ — CID 147433162
[4-[[(4S,5S)-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methoxy]-2-methylbutan-2-yl]-methylsilanylium (PubChem CID 147433162) has the molecular formula C19H32NO5Si+ and a molecular weight of 382.55 g/mol. Its IUPAC name is [4-[[(4S,5S)-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methoxy]-2-methylbutan-2-yl]-methylsilanylium.
| Compound Name | [4-[[(4S,5S)-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methoxy]-2-methylbutan-2-yl]-methylsilanylium |
|---|---|
| PubChem CID | 147433162 |
| Molecular Formula | C19H32NO5Si+ |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [4-[[(4S,5S)-5-[4-(2-methoxyethoxy)phenyl]-2-oxo-1,3-oxazolidin-4-yl]methoxy]-2-methylbutan-2-yl]-methylsilanylium |
| SMILES | COCCOc1ccc([C@@H]2OC(=O)N[C@H]2COCCC(C)(C)[SiH3+]C)cc1 |
| InChI | InChI=1S/C19H32NO5Si/c1-19(2,26-4)9-10-23-13-16-17(25-18(21)20-16)14-5-7-15(8-6-14)24-12-11-22-3/h5-8,16-17H,9-13H2,1-4,26H3,(H,20,21)/q+1/t16-,17-/m0/s1 |
| InChIKey | IKYMBFCNRGXBDU-IRXDYDNUSA-N |
| XLogP | 2.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|